C26H46N4O2 — CID 22902695
N-[[4-[[hydroxy-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]phenyl]methyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)hydroxylamine (PubChem CID 22902695) has the molecular formula C26H46N4O2 and a molecular weight of 446.68 g/mol. Its IUPAC name is N-[[4-[[hydroxy-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]phenyl]methyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)hydroxylamine.
| Compound Name | N-[[4-[[hydroxy-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]phenyl]methyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)hydroxylamine |
|---|---|
| PubChem CID | 22902695 |
| Molecular Formula | C26H46N4O2 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | N-[[4-[[hydroxy-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]phenyl]methyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)hydroxylamine |
| SMILES | CC1(C)CC(N(O)Cc2ccc(CN(O)C3CC(C)(C)NC(C)(C)C3)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C26H46N4O2/c1-23(2)13-21(14-24(3,4)27-23)29(31)17-19-9-11-20(12-10-19)18-30(32)22-15-25(5,6)28-26(7,8)16-22/h9-12,21-22,27-28,31-32H,13-18H2,1-8H3 |
| InChIKey | VJCDAALCAWPYQR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|