C15H30N2O2 — CID 22902715
1-[4-[butyl(hydroxy)amino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanone (PubChem CID 22902715) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-[4-[butyl(hydroxy)amino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanone.
| Compound Name | 1-[4-[butyl(hydroxy)amino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 22902715 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 1-[4-[butyl(hydroxy)amino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanone |
| SMILES | CCCCN(O)C1CC(C)(C)N(C(C)=O)C(C)(C)C1 |
| InChI | InChI=1S/C15H30N2O2/c1-7-8-9-16(19)13-10-14(3,4)17(12(2)18)15(5,6)11-13/h13,19H,7-11H2,1-6H3 |
| InChIKey | JRGYMKFFTRGICU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|