About (Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol
(Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol (PubChem CID 22902804) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is (Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol.
Molecular Properties
| Compound Name | (Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol |
| PubChem CID | 22902804 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol |
| SMILES | C/C(=C/O)CC1OCC(C)(C)CO1 |
| InChI | InChI=1S/C10H18O3/c1-8(5-11)4-9-12-6-10(2,3)7-13-9/h5,9,11H,4,6-7H2,1-3H3/b8-5- |
| InChIKey | HCTPLIYYPBUXLY-YVMONPNESA-N |
| XLogP | 2.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol?
The IUPAC name of (Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol (CID 22902804) is (Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol.
What is the SMILES notation for (Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol?
The canonical SMILES for (Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol is C/C(=C/O)CC1OCC(C)(C)CO1.
What is the InChIKey of (Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol?
The InChIKey is HCTPLIYYPBUXLY-YVMONPNESA-N. The full InChI is InChI=1S/C10H18O3/c1-8(5-11)4-9-12-6-10(2,3)7-13-9/h5,9,11H,4,6-7H2,1-3H3/b8-5-.
What are the key properties of (Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol?
(Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol has a molecular weight of 186.25 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylprop-1-en-1-ol is sourced from PubChem (CID 22902804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).