About 3-ethenyl-1,4-dimethyl-2H-triazole
3-ethenyl-1,4-dimethyl-2H-triazole (PubChem CID 22903109) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 3-ethenyl-1,4-dimethyl-2H-triazole.
Molecular Properties
| Compound Name | 3-ethenyl-1,4-dimethyl-2H-triazole |
| PubChem CID | 22903109 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 3-ethenyl-1,4-dimethyl-2H-triazole |
| SMILES | C=CN1NN(C)C=C1C |
| InChI | InChI=1S/C6H11N3/c1-4-9-6(2)5-8(3)7-9/h4-5,7H,1H2,2-3H3 |
| InChIKey | WHCYRKCHVUYFFN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethenyl-1,4-dimethyl-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-1,4-dimethyl-2H-triazole?
The IUPAC name of 3-ethenyl-1,4-dimethyl-2H-triazole (CID 22903109) is 3-ethenyl-1,4-dimethyl-2H-triazole.
What is the SMILES notation for 3-ethenyl-1,4-dimethyl-2H-triazole?
The canonical SMILES for 3-ethenyl-1,4-dimethyl-2H-triazole is C=CN1NN(C)C=C1C.
What is the InChIKey of 3-ethenyl-1,4-dimethyl-2H-triazole?
The InChIKey is WHCYRKCHVUYFFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-4-9-6(2)5-8(3)7-9/h4-5,7H,1H2,2-3H3.
What are the key properties of 3-ethenyl-1,4-dimethyl-2H-triazole?
3-ethenyl-1,4-dimethyl-2H-triazole has a molecular weight of 125.17 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-1,4-dimethyl-2H-triazole is sourced from PubChem (CID 22903109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).