C30H34N2O6 — CID 22903329
4-(benzylamino)-2-tert-butyl-5-(4-hydroxyphenyl)-3-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 22903329) has the molecular formula C30H34N2O6 and a molecular weight of 518.61 g/mol. Its IUPAC name is 4-(benzylamino)-2-tert-butyl-5-(4-hydroxyphenyl)-3-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 4-(benzylamino)-2-tert-butyl-5-(4-hydroxyphenyl)-3-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 22903329 |
| Molecular Formula | C30H34N2O6 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 4-(benzylamino)-2-tert-butyl-5-(4-hydroxyphenyl)-3-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | CC(C)(C)C(NC(=O)OCc1ccccc1)(C(=O)O)C(=O)C(Cc1ccc(O)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C30H34N2O6/c1-29(2,3)30(27(35)36,32-28(37)38-20-23-12-8-5-9-13-23)26(34)25(18-21-14-16-24(33)17-15-21)31-19-22-10-6-4-7-11-22/h4-17,25,31,33H,18-20H2,1-3H3,(H,32,37)(H,35,36) |
| InChIKey | BQICKTVNORNTNI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|