C27H28ClN3O6S — CID 22903488
2-[[7-chloro-1-[6-[(2-methylbenzoyl)amino]pyridine-3-carbonyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]ethyl methanesulfonate (PubChem CID 22903488) has the molecular formula C27H28ClN3O6S and a molecular weight of 558.06 g/mol. Its IUPAC name is 2-[[7-chloro-1-[6-[(2-methylbenzoyl)amino]pyridine-3-carbonyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]ethyl methanesulfonate.
| Compound Name | 2-[[7-chloro-1-[6-[(2-methylbenzoyl)amino]pyridine-3-carbonyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 22903488 |
| Molecular Formula | C27H28ClN3O6S |
| Molecular Weight | 558.06 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | 2-[[7-chloro-1-[6-[(2-methylbenzoyl)amino]pyridine-3-carbonyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]ethyl methanesulfonate |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(C(=O)N2CCCC(OCCOS(C)(=O)=O)c3cc(Cl)ccc32)cn1 |
| InChI | InChI=1S/C27H28ClN3O6S/c1-18-6-3-4-7-21(18)26(32)30-25-12-9-19(17-29-25)27(33)31-13-5-8-24(36-14-15-37-38(2,34)35)22-16-20(28)10-11-23(22)31/h3-4,6-7,9-12,16-17,24H,5,8,13-15H2,1-2H3,(H,29,30,32) |
| InChIKey | MWDWKHNBUYFXSU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.06 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|