About 2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone
2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone (PubChem CID 22903782) has the molecular formula C5H6BrNOS
and a molecular weight of 208.08 g/mol. Its IUPAC name is 2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone.
Molecular Properties
| Compound Name | 2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone |
| PubChem CID | 22903782 |
| Molecular Formula | C5H6BrNOS |
| Molecular Weight | 208.08 g/mol |
| Exact Mass | 206.94 |
| IUPAC Name | 2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone |
| SMILES | O=C(CBr)N1C=CSC1 |
| InChI | InChI=1S/C5H6BrNOS/c6-3-5(8)7-1-2-9-4-7/h1-2H,3-4H2 |
| InChIKey | BKJPKCCAZLLXEJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.08 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone?
The IUPAC name of 2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone (CID 22903782) is 2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone.
What is the SMILES notation for 2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone?
The canonical SMILES for 2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone is O=C(CBr)N1C=CSC1.
What is the InChIKey of 2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone?
The InChIKey is BKJPKCCAZLLXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6BrNOS/c6-3-5(8)7-1-2-9-4-7/h1-2H,3-4H2.
What are the key properties of 2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone?
2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone has a molecular weight of 208.08 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(2H-1,3-thiazol-3-yl)ethanone is sourced from PubChem (CID 22903782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).