C23H26N2O2S — CID 22903846
2-[5-[2-(7-ethyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetic acid (PubChem CID 22903846) has the molecular formula C23H26N2O2S and a molecular weight of 394.54 g/mol. Its IUPAC name is 2-[5-[2-(7-ethyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetic acid.
| Compound Name | 2-[5-[2-(7-ethyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 22903846 |
| Molecular Formula | C23H26N2O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 2-[5-[2-(7-ethyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetic acid |
| SMILES | CCc1cc2c(cc1C#Cc1cnc(CC(=O)O)nc1)C(C)(C)CC(C)(C)S2 |
| InChI | InChI=1S/C23H26N2O2S/c1-6-16-10-19-18(22(2,3)14-23(4,5)28-19)9-17(16)8-7-15-12-24-20(25-13-15)11-21(26)27/h9-10,12-13H,6,11,14H2,1-5H3,(H,26,27) |
| InChIKey | ZRUBFILONHPFOK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|