C21H21N2O2S- — CID 22903885
2-[5-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate (PubChem CID 22903885) has the molecular formula C21H21N2O2S- and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-[5-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate.
| Compound Name | 2-[5-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate |
|---|---|
| PubChem CID | 22903885 |
| Molecular Formula | C21H21N2O2S- |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-[5-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate |
| SMILES | CC1(C)CC(C)(C)c2cc(C#Cc3cnc(CC(=O)[O-])cn3)ccc2S1 |
| InChI | InChI=1S/C21H22N2O2S/c1-20(2)13-21(3,4)26-18-8-6-14(9-17(18)20)5-7-15-11-23-16(12-22-15)10-19(24)25/h6,8-9,11-12H,10,13H2,1-4H3,(H,24,25)/p-1 |
| InChIKey | KIFRDVJLPSYQTP-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|