C18H21N3O2S — CID 2290434
1-N-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-N,4-N-diethyl-2-methylbenzene-1,4-diamine (PubChem CID 2290434) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-N-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-N,4-N-diethyl-2-methylbenzene-1,4-diamine.
| Compound Name | 1-N-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-N,4-N-diethyl-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 2290434 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-N-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-N,4-N-diethyl-2-methylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(NC2=NS(=O)(=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C18H21N3O2S/c1-4-21(5-2)14-10-11-16(13(3)12-14)19-18-15-8-6-7-9-17(15)24(22,23)20-18/h6-12H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | LCFVCVAGNYTAIU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|