About methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 22904543) has the molecular formula C15H19F2NO5
and a molecular weight of 331.32 g/mol. Its IUPAC name is methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
Molecular Properties
| Compound Name | methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| PubChem CID | 22904543 |
| Molecular Formula | C15H19F2NO5 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)C(O)C(NC(=O)OC(C)(C)C)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H19F2NO5/c1-15(2,3)23-14(21)18-11(12(19)13(20)22-4)9-6-5-8(16)7-10(9)17/h5-7,11-12,19H,1-4H3,(H,18,21) |
| InChIKey | LPIBXDQNXWZZKZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The IUPAC name of methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CID 22904543) is methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
What is the SMILES notation for methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The canonical SMILES for methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate is COC(=O)C(O)C(NC(=O)OC(C)(C)C)c1ccc(F)cc1F.
What is the InChIKey of methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The InChIKey is LPIBXDQNXWZZKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2NO5/c1-15(2,3)23-14(21)18-11(12(19)13(20)22-4)9-6-5-8(16)7-10(9)17/h5-7,11-12,19H,1-4H3,(H,18,21).
What are the key properties of methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate has a molecular weight of 331.32 g/mol, XLogP of 2.06, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,4-difluorophenyl)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate is sourced from PubChem (CID 22904543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).