About N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide
N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide (PubChem CID 2290457) has the molecular formula C13H17ClN2O2
and a molecular weight of 268.74 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide.
Molecular Properties
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide |
| PubChem CID | 2290457 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-9(2)16-13(18)12(17)15-8-7-10-3-5-11(14)6-4-10/h3-6,9H,7-8H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | DOCPFYZRWRPAFV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide?
The IUPAC name of N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide (CID 2290457) is N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide.
What is the SMILES notation for N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide?
The canonical SMILES for N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide is CC(C)NC(=O)C(=O)NCCc1ccc(Cl)cc1.
What is the InChIKey of N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide?
The InChIKey is DOCPFYZRWRPAFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O2/c1-9(2)16-13(18)12(17)15-8-7-10-3-5-11(14)6-4-10/h3-6,9H,7-8H2,1-2H3,(H,15,17)(H,16,18).
What are the key properties of N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide?
N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide has a molecular weight of 268.74 g/mol, XLogP of 1.52, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-chlorophenyl)ethyl]-N'-propan-2-yloxamide is sourced from PubChem (CID 2290457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).