About 1-ethenylpyrrolidin-2-one;furan-2,5-dione
1-ethenylpyrrolidin-2-one;furan-2,5-dione (PubChem CID 22904624) has the molecular formula C10H11NO4
and a molecular weight of 209.20 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;furan-2,5-dione.
Molecular Properties
| Compound Name | 1-ethenylpyrrolidin-2-one;furan-2,5-dione |
| PubChem CID | 22904624 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;furan-2,5-dione |
| SMILES | C=CN1CCCC1=O.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C6H9NO.C4H2O3/c1-2-7-5-3-4-6(7)8;5-3-1-2-4(6)7-3/h2H,1,3-5H2;1-2H |
| InChIKey | KTHZGUZLCWLVKL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylpyrrolidin-2-one;furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylpyrrolidin-2-one;furan-2,5-dione?
The IUPAC name of 1-ethenylpyrrolidin-2-one;furan-2,5-dione (CID 22904624) is 1-ethenylpyrrolidin-2-one;furan-2,5-dione.
What is the SMILES notation for 1-ethenylpyrrolidin-2-one;furan-2,5-dione?
The canonical SMILES for 1-ethenylpyrrolidin-2-one;furan-2,5-dione is C=CN1CCCC1=O.O=C1C=CC(=O)O1.
What is the InChIKey of 1-ethenylpyrrolidin-2-one;furan-2,5-dione?
The InChIKey is KTHZGUZLCWLVKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C4H2O3/c1-2-7-5-3-4-6(7)8;5-3-1-2-4(6)7-3/h2H,1,3-5H2;1-2H.
What are the key properties of 1-ethenylpyrrolidin-2-one;furan-2,5-dione?
1-ethenylpyrrolidin-2-one;furan-2,5-dione has a molecular weight of 209.20 g/mol, XLogP of 0.38, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylpyrrolidin-2-one;furan-2,5-dione is sourced from PubChem (CID 22904624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).