C25H28F3N3O4 — CID 22904890
3-[7-(5-aminopentyl)-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,4-benzodiazepin-4-yl]propanoic acid (PubChem CID 22904890) has the molecular formula C25H28F3N3O4 and a molecular weight of 491.51 g/mol. Its IUPAC name is 3-[7-(5-aminopentyl)-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,4-benzodiazepin-4-yl]propanoic acid.
| Compound Name | 3-[7-(5-aminopentyl)-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,4-benzodiazepin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 22904890 |
| Molecular Formula | C25H28F3N3O4 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 3-[7-(5-aminopentyl)-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,4-benzodiazepin-4-yl]propanoic acid |
| SMILES | NCCCCCc1ccc2c(c1)C(=O)N(CCC(=O)O)CC(=O)N2Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H28F3N3O4/c26-25(27,28)19-8-5-18(6-9-19)15-31-21-10-7-17(4-2-1-3-12-29)14-20(21)24(35)30(16-22(31)32)13-11-23(33)34/h5-10,14H,1-4,11-13,15-16,29H2,(H,33,34) |
| InChIKey | HMRYAXGTRVOOIO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|