C23H32F3N3O6 — CID 22904895
3-[7-(5-aminopentyl)-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22904895) has the molecular formula C23H32F3N3O6 and a molecular weight of 503.52 g/mol. Its IUPAC name is 3-[7-(5-aminopentyl)-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-(5-aminopentyl)-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22904895 |
| Molecular Formula | C23H32F3N3O6 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 3-[7-(5-aminopentyl)-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(CC(=O)O)N1CC(=O)N(C(C)C)c2ccc(CCCCCN)cc2C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H31N3O4.C2HF3O2/c1-14(2)24-18-9-8-16(7-5-4-6-10-22)12-17(18)21(28)23(13-19(24)25)15(3)11-20(26)27;3-2(4,5)1(6)7/h8-9,12,14-15H,4-7,10-11,13,22H2,1-3H3,(H,26,27);(H,6,7) |
| InChIKey | LKGAMKPZKFQDFI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 141.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|