C26H30F3N3O4 — CID 22904922
3-[7-(6-aminohexyl)-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,4-benzodiazepin-4-yl]propanoic acid (PubChem CID 22904922) has the molecular formula C26H30F3N3O4 and a molecular weight of 505.54 g/mol. Its IUPAC name is 3-[7-(6-aminohexyl)-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,4-benzodiazepin-4-yl]propanoic acid.
| Compound Name | 3-[7-(6-aminohexyl)-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,4-benzodiazepin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 22904922 |
| Molecular Formula | C26H30F3N3O4 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 3-[7-(6-aminohexyl)-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,4-benzodiazepin-4-yl]propanoic acid |
| SMILES | NCCCCCCc1ccc2c(c1)C(=O)N(CCC(=O)O)CC(=O)N2Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H30F3N3O4/c27-26(28,29)20-9-6-19(7-10-20)16-32-22-11-8-18(5-3-1-2-4-13-30)15-21(22)25(36)31(17-23(32)33)14-12-24(34)35/h6-11,15H,1-5,12-14,16-17,30H2,(H,34,35) |
| InChIKey | SEBXXOBIQKVXTP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|