C26H30F3N3O6 — CID 22904925
3-[7-(5-aminopentyl)-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22904925) has the molecular formula C26H30F3N3O6 and a molecular weight of 537.54 g/mol. Its IUPAC name is 3-[7-(5-aminopentyl)-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-(5-aminopentyl)-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22904925 |
| Molecular Formula | C26H30F3N3O6 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 3-[7-(5-aminopentyl)-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(CC(=O)O)N1CC(=O)N(c2ccccc2)c2ccc(CCCCCN)cc2C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H29N3O4.C2HF3O2/c1-17(14-23(29)30)26-16-22(28)27(19-9-5-2-6-10-19)21-12-11-18(8-4-3-7-13-25)15-20(21)24(26)31;3-2(4,5)1(6)7/h2,5-6,9-12,15,17H,3-4,7-8,13-14,16,25H2,1H3,(H,29,30);(H,6,7) |
| InChIKey | ZSTOAABJZHLLHN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 141.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|