C24H29N3O4 — CID 22904995
3-[7-(5-aminopentyl)-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid (PubChem CID 22904995) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 3-[7-(5-aminopentyl)-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid.
| Compound Name | 3-[7-(5-aminopentyl)-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22904995 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 3-[7-(5-aminopentyl)-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid |
| SMILES | CN1C(=O)CN(C(CC(=O)O)c2ccccc2)C(=O)c2cc(CCCCCN)ccc21 |
| InChI | InChI=1S/C24H29N3O4/c1-26-20-12-11-17(8-4-3-7-13-25)14-19(20)24(31)27(16-22(26)28)21(15-23(29)30)18-9-5-2-6-10-18/h2,5-6,9-12,14,21H,3-4,7-8,13,15-16,25H2,1H3,(H,29,30) |
| InChIKey | DIRSYJHKAHZYNU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|