C30H34N4O5 — CID 22905007
3-[7-[4-[(2-amino-3-pyridinyl)oxy]butyl]-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid (PubChem CID 22905007) has the molecular formula C30H34N4O5 and a molecular weight of 530.63 g/mol. Its IUPAC name is 3-[7-[4-[(2-amino-3-pyridinyl)oxy]butyl]-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid.
| Compound Name | 3-[7-[4-[(2-amino-3-pyridinyl)oxy]butyl]-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22905007 |
| Molecular Formula | C30H34N4O5 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 3-[7-[4-[(2-amino-3-pyridinyl)oxy]butyl]-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid |
| SMILES | CC(C)N1C(=O)CN(C(CC(=O)O)c2ccccc2)C(=O)c2cc(CCCCOc3cccnc3N)ccc21 |
| InChI | InChI=1S/C30H34N4O5/c1-20(2)34-24-14-13-21(9-6-7-16-39-26-12-8-15-32-29(26)31)17-23(24)30(38)33(19-27(34)35)25(18-28(36)37)22-10-4-3-5-11-22/h3-5,8,10-15,17,20,25H,6-7,9,16,18-19H2,1-2H3,(H2,31,32)(H,36,37) |
| InChIKey | GGILYQWKHWEPJK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|