C32H34F3N3O6 — CID 22905031
3-[7-(5-aminopentyl)-2,5-dioxo-1,3-diphenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22905031) has the molecular formula C32H34F3N3O6 and a molecular weight of 613.63 g/mol. Its IUPAC name is 3-[7-(5-aminopentyl)-2,5-dioxo-1,3-diphenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-(5-aminopentyl)-2,5-dioxo-1,3-diphenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22905031 |
| Molecular Formula | C32H34F3N3O6 |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | 3-[7-(5-aminopentyl)-2,5-dioxo-1,3-diphenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(CC(=O)O)N1C(=O)c2cc(CCCCCN)ccc2N(c2ccccc2)C(=O)C1c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H33N3O4.C2HF3O2/c1-21(19-27(34)35)32-28(23-12-6-2-7-13-23)30(37)33(24-14-8-3-9-15-24)26-17-16-22(11-5-4-10-18-31)20-25(26)29(32)36;3-2(4,5)1(6)7/h2-3,6-9,12-17,20-21,28H,4-5,10-11,18-19,31H2,1H3,(H,34,35);(H,6,7) |
| InChIKey | VAGNJXCYCCYOSY-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 141.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|