C33H36F3N3O6 — CID 22905067
3-[7-(5-aminopentyl)-1-benzyl-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22905067) has the molecular formula C33H36F3N3O6 and a molecular weight of 627.66 g/mol. Its IUPAC name is 3-[7-(5-aminopentyl)-1-benzyl-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-(5-aminopentyl)-1-benzyl-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22905067 |
| Molecular Formula | C33H36F3N3O6 |
| Molecular Weight | 627.66 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | 3-[7-(5-aminopentyl)-1-benzyl-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(CC(=O)O)N1C(=O)c2cc(CCCCCN)ccc2N(Cc2ccccc2)C(=O)C1c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H35N3O4.C2HF3O2/c1-22(19-28(35)36)34-29(25-14-8-3-9-15-25)31(38)33(21-24-12-5-2-6-13-24)27-17-16-23(11-7-4-10-18-32)20-26(27)30(34)37;3-2(4,5)1(6)7/h2-3,5-6,8-9,12-17,20,22,29H,4,7,10-11,18-19,21,32H2,1H3,(H,35,36);(H,6,7) |
| InChIKey | NYRLSEMBPFIDPW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 141.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|