C25H32N4O5 — CID 22905113
3-[7-[4-[(2-amino-3-pyridinyl)oxy]butyl]-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]butanoic acid (PubChem CID 22905113) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is 3-[7-[4-[(2-amino-3-pyridinyl)oxy]butyl]-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]butanoic acid.
| Compound Name | 3-[7-[4-[(2-amino-3-pyridinyl)oxy]butyl]-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 22905113 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 3-[7-[4-[(2-amino-3-pyridinyl)oxy]butyl]-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]butanoic acid |
| SMILES | CC(CC(=O)O)N1CC(=O)N(C(C)C)c2ccc(CCCCOc3cccnc3N)cc2C1=O |
| InChI | InChI=1S/C25H32N4O5/c1-16(2)29-20-10-9-18(7-4-5-12-34-21-8-6-11-27-24(21)26)14-19(20)25(33)28(15-22(29)30)17(3)13-23(31)32/h6,8-11,14,16-17H,4-5,7,12-13,15H2,1-3H3,(H2,26,27)(H,31,32) |
| InChIKey | LQNAKCBFRCVMFY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|