C19H14Cl2N2O3 — CID 2290512
(4E)-1-(3,5-dichlorophenyl)-4-[[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrazolidine-3,5-dione (PubChem CID 2290512) has the molecular formula C19H14Cl2N2O3 and a molecular weight of 389.24 g/mol. Its IUPAC name is (4E)-1-(3,5-dichlorophenyl)-4-[[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrazolidine-3,5-dione.
| Compound Name | (4E)-1-(3,5-dichlorophenyl)-4-[[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 2290512 |
| Molecular Formula | C19H14Cl2N2O3 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | (4E)-1-(3,5-dichlorophenyl)-4-[[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrazolidine-3,5-dione |
| SMILES | C[C@H]1Cc2cc(/C=C3\C(=O)NN(c4cc(Cl)cc(Cl)c4)C3=O)ccc2O1 |
| InChI | InChI=1S/C19H14Cl2N2O3/c1-10-4-12-5-11(2-3-17(12)26-10)6-16-18(24)22-23(19(16)25)15-8-13(20)7-14(21)9-15/h2-3,5-10H,4H2,1H3,(H,22,24)/b16-6+/t10-/m0/s1 |
| InChIKey | DKYLXPXPXYCNBP-JIURPICXSA-N |
| XLogP | 3.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|