C27H32F3N5O4 — CID 22905350
3-[7-[6-(diaminomethylideneamino)hexyl]-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,4-benzodiazepin-4-yl]propanoic acid (PubChem CID 22905350) has the molecular formula C27H32F3N5O4 and a molecular weight of 547.58 g/mol. Its IUPAC name is 3-[7-[6-(diaminomethylideneamino)hexyl]-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,4-benzodiazepin-4-yl]propanoic acid.
| Compound Name | 3-[7-[6-(diaminomethylideneamino)hexyl]-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,4-benzodiazepin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 22905350 |
| Molecular Formula | C27H32F3N5O4 |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 3-[7-[6-(diaminomethylideneamino)hexyl]-2,5-dioxo-1-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,4-benzodiazepin-4-yl]propanoic acid |
| SMILES | NC(N)=NCCCCCCc1ccc2c(c1)C(=O)N(CCC(=O)O)CC(=O)N2Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H32F3N5O4/c28-27(29,30)20-9-6-19(7-10-20)16-35-22-11-8-18(5-3-1-2-4-13-33-26(31)32)15-21(22)25(39)34(17-23(35)36)14-12-24(37)38/h6-11,15H,1-5,12-14,16-17H2,(H,37,38)(H4,31,32,33) |
| InChIKey | OCQAKFVACXDVLJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|