C33H39NO5 — CID 22906000
6-[[5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]-6-oxohexanoic acid (PubChem CID 22906000) has the molecular formula C33H39NO5 and a molecular weight of 529.68 g/mol. Its IUPAC name is 6-[[5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]-6-oxohexanoic acid.
| Compound Name | 6-[[5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 22906000 |
| Molecular Formula | C33H39NO5 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 6-[[5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]-6-oxohexanoic acid |
| SMILES | CCCN(C(=O)CCCCC(=O)O)C1CCc2c(ccc(OCc3ccccc3)c2OCc2ccccc2)C1 |
| InChI | InChI=1S/C33H39NO5/c1-2-21-34(31(35)15-9-10-16-32(36)37)28-18-19-29-27(22-28)17-20-30(38-23-25-11-5-3-6-12-25)33(29)39-24-26-13-7-4-8-14-26/h3-8,11-14,17,20,28H,2,9-10,15-16,18-19,21-24H2,1H3,(H,36,37) |
| InChIKey | HYENAEHHBZHENV-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|