C28H42N2O4 — CID 22906017
6-[6-[3-(3,4-dihydroxyphenyl)propylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol (PubChem CID 22906017) has the molecular formula C28H42N2O4 and a molecular weight of 470.65 g/mol. Its IUPAC name is 6-[6-[3-(3,4-dihydroxyphenyl)propylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol.
| Compound Name | 6-[6-[3-(3,4-dihydroxyphenyl)propylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 22906017 |
| Molecular Formula | C28H42N2O4 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | 6-[6-[3-(3,4-dihydroxyphenyl)propylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
| SMILES | CCCN(CCCCCCNCCCc1ccc(O)c(O)c1)C1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C28H42N2O4/c1-2-17-30(23-11-12-24-22(20-23)10-14-26(32)28(24)34)18-6-4-3-5-15-29-16-7-8-21-9-13-25(31)27(33)19-21/h9-10,13-14,19,23,29,31-34H,2-8,11-12,15-18,20H2,1H3 |
| InChIKey | NDPKHIJEEOWRDV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|