C16H27NO5 — CID 22906298
3-O-ethyl 2-O-methyl 6-(2-hydroxyethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate (PubChem CID 22906298) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is 3-O-ethyl 2-O-methyl 6-(2-hydroxyethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate.
| Compound Name | 3-O-ethyl 2-O-methyl 6-(2-hydroxyethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 22906298 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 3-O-ethyl 2-O-methyl 6-(2-hydroxyethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1CC2CC(CCO)CCC2CN1C(=O)OC |
| InChI | InChI=1S/C16H27NO5/c1-3-22-15(19)14-9-13-8-11(6-7-18)4-5-12(13)10-17(14)16(20)21-2/h11-14,18H,3-10H2,1-2H3 |
| InChIKey | QWCZTYHNDZYKDM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |