About adamantan-1-amine;4-methylbenzenesulfonamide
adamantan-1-amine;4-methylbenzenesulfonamide (PubChem CID 22906575) has the molecular formula C17H26N2O2S
and a molecular weight of 322.47 g/mol. Its IUPAC name is adamantan-1-amine;4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | adamantan-1-amine;4-methylbenzenesulfonamide |
| PubChem CID | 22906575 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | adamantan-1-amine;4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1.NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H17N.C7H9NO2S/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-6-2-4-7(5-3-6)11(8,9)10/h7-9H,1-6,11H2;2-5H,1H3,(H2,8,9,10) |
| InChIKey | NRDFFZLYYBYSAX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze adamantan-1-amine;4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantan-1-amine;4-methylbenzenesulfonamide?
The IUPAC name of adamantan-1-amine;4-methylbenzenesulfonamide (CID 22906575) is adamantan-1-amine;4-methylbenzenesulfonamide.
What is the SMILES notation for adamantan-1-amine;4-methylbenzenesulfonamide?
The canonical SMILES for adamantan-1-amine;4-methylbenzenesulfonamide is Cc1ccc(S(N)(=O)=O)cc1.NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of adamantan-1-amine;4-methylbenzenesulfonamide?
The InChIKey is NRDFFZLYYBYSAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.C7H9NO2S/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-6-2-4-7(5-3-6)11(8,9)10/h7-9H,1-6,11H2;2-5H,1H3,(H2,8,9,10).
What are the key properties of adamantan-1-amine;4-methylbenzenesulfonamide?
adamantan-1-amine;4-methylbenzenesulfonamide has a molecular weight of 322.47 g/mol, XLogP of 2.56, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for adamantan-1-amine;4-methylbenzenesulfonamide is sourced from PubChem (CID 22906575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).