About urea;hydrofluoride
urea;hydrofluoride (PubChem CID 22906606) has the molecular formula CH5FN2O
and a molecular weight of 80.06 g/mol. Its IUPAC name is urea;hydrofluoride.
Molecular Properties
| Compound Name | urea;hydrofluoride |
| PubChem CID | 22906606 |
| Molecular Formula | CH5FN2O |
| Molecular Weight | 80.06 g/mol |
| Exact Mass | 80.04 |
| IUPAC Name | urea;hydrofluoride |
| SMILES | F.NC(N)=O |
| InChI | InChI=1S/CH4N2O.FH/c2-1(3)4;/h(H4,2,3,4);1H |
| InChIKey | ITDRVJXDQOONPC-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 80.06 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze urea;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of urea;hydrofluoride?
The IUPAC name of urea;hydrofluoride (CID 22906606) is urea;hydrofluoride.
What is the SMILES notation for urea;hydrofluoride?
The canonical SMILES for urea;hydrofluoride is F.NC(N)=O.
What is the InChIKey of urea;hydrofluoride?
The InChIKey is ITDRVJXDQOONPC-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.FH/c2-1(3)4;/h(H4,2,3,4);1H.
What are the key properties of urea;hydrofluoride?
urea;hydrofluoride has a molecular weight of 80.06 g/mol, XLogP of -0.82, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for urea;hydrofluoride is sourced from PubChem (CID 22906606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).