C8H3Cl5O — CID 22906675
2-(2,3,4,5,6-pentachlorophenyl)oxirane (PubChem CID 22906675) has the molecular formula C8H3Cl5O and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentachlorophenyl)oxirane.
| Compound Name | 2-(2,3,4,5,6-pentachlorophenyl)oxirane |
|---|---|
| PubChem CID | 22906675 |
| Molecular Formula | C8H3Cl5O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 289.86 |
| IUPAC Name | 2-(2,3,4,5,6-pentachlorophenyl)oxirane |
| SMILES | Clc1c(Cl)c(Cl)c(C2CO2)c(Cl)c1Cl |
| InChI | InChI=1S/C8H3Cl5O/c9-4-3(2-1-14-2)5(10)7(12)8(13)6(4)11/h2H,1H2 |
| InChIKey | YJFKQKODUFAFEJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|