About 4-aminopiperidine-4-carboxylic acid;dihydrochloride
4-aminopiperidine-4-carboxylic acid;dihydrochloride (PubChem CID 22907088) has the molecular formula C6H14Cl2N2O2
and a molecular weight of 217.10 g/mol. Its IUPAC name is 4-aminopiperidine-4-carboxylic acid;dihydrochloride.
Molecular Properties
| Compound Name | 4-aminopiperidine-4-carboxylic acid;dihydrochloride |
| PubChem CID | 22907088 |
| Molecular Formula | C6H14Cl2N2O2 |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 4-aminopiperidine-4-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.NC1(C(=O)O)CCNCC1 |
| InChI | InChI=1S/C6H12N2O2.2ClH/c7-6(5(9)10)1-3-8-4-2-6;;/h8H,1-4,7H2,(H,9,10);2*1H |
| InChIKey | QAZLRRMYUONDHH-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-aminopiperidine-4-carboxylic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopiperidine-4-carboxylic acid;dihydrochloride?
The IUPAC name of 4-aminopiperidine-4-carboxylic acid;dihydrochloride (CID 22907088) is 4-aminopiperidine-4-carboxylic acid;dihydrochloride.
What is the SMILES notation for 4-aminopiperidine-4-carboxylic acid;dihydrochloride?
The canonical SMILES for 4-aminopiperidine-4-carboxylic acid;dihydrochloride is Cl.Cl.NC1(C(=O)O)CCNCC1.
What is the InChIKey of 4-aminopiperidine-4-carboxylic acid;dihydrochloride?
The InChIKey is QAZLRRMYUONDHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2.2ClH/c7-6(5(9)10)1-3-8-4-2-6;;/h8H,1-4,7H2,(H,9,10);2*1H.
What are the key properties of 4-aminopiperidine-4-carboxylic acid;dihydrochloride?
4-aminopiperidine-4-carboxylic acid;dihydrochloride has a molecular weight of 217.10 g/mol, XLogP of -0.00, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopiperidine-4-carboxylic acid;dihydrochloride is sourced from PubChem (CID 22907088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).