About 6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene
6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene (PubChem CID 22907363) has the molecular formula C20H14Cl2F2O2S
and a molecular weight of 427.30 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene.
Molecular Properties
| Compound Name | 6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene |
| PubChem CID | 22907363 |
| Molecular Formula | C20H14Cl2F2O2S |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene |
| SMILES | O=S(=O)(c1ccc(C2=CC3(C=C2c2ccc(Cl)c(Cl)c2)CC3)cc1)C(F)F |
| InChI | InChI=1S/C20H14Cl2F2O2S/c21-17-6-3-13(9-18(17)22)16-11-20(7-8-20)10-15(16)12-1-4-14(5-2-12)27(25,26)19(23)24/h1-6,9-11,19H,7-8H2 |
| InChIKey | FDPXOUVHRUONEU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene?
The IUPAC name of 6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene (CID 22907363) is 6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene.
What is the SMILES notation for 6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene?
The canonical SMILES for 6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene is O=S(=O)(c1ccc(C2=CC3(C=C2c2ccc(Cl)c(Cl)c2)CC3)cc1)C(F)F.
What is the InChIKey of 6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene?
The InChIKey is FDPXOUVHRUONEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Cl2F2O2S/c21-17-6-3-13(9-18(17)22)16-11-20(7-8-20)10-15(16)12-1-4-14(5-2-12)27(25,26)19(23)24/h1-6,9-11,19H,7-8H2.
What are the key properties of 6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene?
6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene has a molecular weight of 427.30 g/mol, XLogP of 6.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dichlorophenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene is sourced from PubChem (CID 22907363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).