About 6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene
6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene (PubChem CID 22907695) has the molecular formula C21H19ClO3S
and a molecular weight of 386.90 g/mol. Its IUPAC name is 6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene.
Molecular Properties
| Compound Name | 6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene |
| PubChem CID | 22907695 |
| Molecular Formula | C21H19ClO3S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene |
| SMILES | COc1ccc(C2=CC3(C=C2c2ccc(S(C)(=O)=O)cc2)CC3)cc1Cl |
| InChI | InChI=1S/C21H19ClO3S/c1-25-20-8-5-15(11-19(20)22)18-13-21(9-10-21)12-17(18)14-3-6-16(7-4-14)26(2,23)24/h3-8,11-13H,9-10H2,1-2H3 |
| InChIKey | WLFJJROWUATIOC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene?
The IUPAC name of 6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene (CID 22907695) is 6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene.
What is the SMILES notation for 6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene?
The canonical SMILES for 6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene is COc1ccc(C2=CC3(C=C2c2ccc(S(C)(=O)=O)cc2)CC3)cc1Cl.
What is the InChIKey of 6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene?
The InChIKey is WLFJJROWUATIOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19ClO3S/c1-25-20-8-5-15(11-19(20)22)18-13-21(9-10-21)12-17(18)14-3-6-16(7-4-14)26(2,23)24/h3-8,11-13H,9-10H2,1-2H3.
What are the key properties of 6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene?
6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene has a molecular weight of 386.90 g/mol, XLogP of 5.01, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-chloro-4-methoxyphenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hepta-4,6-diene is sourced from PubChem (CID 22907695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).