About S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate
S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate (PubChem CID 22907985) has the molecular formula C16H22N2O3S
and a molecular weight of 322.43 g/mol. Its IUPAC name is S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate.
Molecular Properties
| Compound Name | S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate |
| PubChem CID | 22907985 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate |
| SMILES | C=CCOC(=O)N(C)CCCCC(=O)SCc1ccccn1 |
| InChI | InChI=1S/C16H22N2O3S/c1-3-12-21-16(20)18(2)11-7-5-9-15(19)22-13-14-8-4-6-10-17-14/h3-4,6,8,10H,1,5,7,9,11-13H2,2H3 |
| InChIKey | CNQVJVIADOKWGO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate?
The IUPAC name of S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate (CID 22907985) is S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate.
What is the SMILES notation for S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate?
The canonical SMILES for S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate is C=CCOC(=O)N(C)CCCCC(=O)SCc1ccccn1.
What is the InChIKey of S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate?
The InChIKey is CNQVJVIADOKWGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O3S/c1-3-12-21-16(20)18(2)11-7-5-9-15(19)22-13-14-8-4-6-10-17-14/h3-4,6,8,10H,1,5,7,9,11-13H2,2H3.
What are the key properties of S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate?
S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate has a molecular weight of 322.43 g/mol, XLogP of 3.27, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-(pyridin-2-ylmethyl) 5-[methyl(prop-2-enoxycarbonyl)amino]pentanethioate is sourced from PubChem (CID 22907985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).