[(E)-but-2-enyl] hydrogen carbonate

C5H8O3 — CID 22908323

IUPAC[(E)-but-2-enyl] hydrogen carbonate
SMILESC/C=C/COC(=O)O
InChIInChI=1S/C5H8O3/c1-2-3-4-8-5(6)7/h2-3H,4H2,1H3,(H,6,7)/b3-2+
InChIKeyIJWQEEONDXVIGH-NSCUHMNNSA-N
MW116.12 g/mol
LogP1.26
Rot. Bonds2

About [(E)-but-2-enyl] hydrogen carbonate

[(E)-but-2-enyl] hydrogen carbonate (PubChem CID 22908323) has the molecular formula C5H8O3 and a molecular weight of 116.12 g/mol. Its IUPAC name is [(E)-but-2-enyl] hydrogen carbonate.

Molecular Properties

Compound Name[(E)-but-2-enyl] hydrogen carbonate
PubChem CID22908323
Molecular FormulaC5H8O3
Molecular Weight116.12 g/mol
Exact Mass116.05
IUPAC Name[(E)-but-2-enyl] hydrogen carbonate
SMILESC/C=C/COC(=O)O
InChIInChI=1S/C5H8O3/c1-2-3-4-8-5(6)7/h2-3H,4H2,1H3,(H,6,7)/b3-2+
InChIKeyIJWQEEONDXVIGH-NSCUHMNNSA-N
XLogP1.26
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500116.12
LogP ≤ 51.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze [(E)-but-2-enyl] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(E)-but-2-enyl] hydrogen carbonate?
The IUPAC name of [(E)-but-2-enyl] hydrogen carbonate (CID 22908323) is [(E)-but-2-enyl] hydrogen carbonate.
What is the SMILES notation for [(E)-but-2-enyl] hydrogen carbonate?
The canonical SMILES for [(E)-but-2-enyl] hydrogen carbonate is C/C=C/COC(=O)O.
What is the InChIKey of [(E)-but-2-enyl] hydrogen carbonate?
The InChIKey is IJWQEEONDXVIGH-NSCUHMNNSA-N. The full InChI is InChI=1S/C5H8O3/c1-2-3-4-8-5(6)7/h2-3H,4H2,1H3,(H,6,7)/b3-2+.
What are the key properties of [(E)-but-2-enyl] hydrogen carbonate?
[(E)-but-2-enyl] hydrogen carbonate has a molecular weight of 116.12 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-enyl] hydrogen carbonate is sourced from PubChem (CID 22908323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).