C17H12F10N2 — CID 22908509
4-[3-(4-aminophenyl)-1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yl]aniline (PubChem CID 22908509) has the molecular formula C17H12F10N2 and a molecular weight of 434.28 g/mol. Its IUPAC name is 4-[3-(4-aminophenyl)-1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yl]aniline.
| Compound Name | 4-[3-(4-aminophenyl)-1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yl]aniline |
|---|---|
| PubChem CID | 22908509 |
| Molecular Formula | C17H12F10N2 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 4-[3-(4-aminophenyl)-1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yl]aniline |
| SMILES | Nc1ccc(C(c2ccc(N)cc2)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12F10N2/c18-14(19,16(22,23)24)13(15(20,21)17(25,26)27,9-1-5-11(28)6-2-9)10-3-7-12(29)8-4-10/h1-8H,28-29H2 |
| InChIKey | FCJXAMZSWIKOAR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|