C10H3ClF7N3O2 — CID 22908735
6-chloro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-nitro-1H-benzimidazole (PubChem CID 22908735) has the molecular formula C10H3ClF7N3O2 and a molecular weight of 365.59 g/mol. Its IUPAC name is 6-chloro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-nitro-1H-benzimidazole.
| Compound Name | 6-chloro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-nitro-1H-benzimidazole |
|---|---|
| PubChem CID | 22908735 |
| Molecular Formula | C10H3ClF7N3O2 |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 6-chloro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-nitro-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1cc(Cl)cc2[nH]c(C(F)(F)C(F)(F)C(F)(F)F)nc12 |
| InChI | InChI=1S/C10H3ClF7N3O2/c11-3-1-4-6(5(2-3)21(22)23)20-7(19-4)8(12,13)9(14,15)10(16,17)18/h1-2H,(H,19,20) |
| InChIKey | OCJNAHVWDIILEL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|