C30H45N5O7 — CID 22909284
N-[11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxyundecyl]-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 22909284) has the molecular formula C30H45N5O7 and a molecular weight of 587.72 g/mol. Its IUPAC name is N-[11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxyundecyl]-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | N-[11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxyundecyl]-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 22909284 |
| Molecular Formula | C30H45N5O7 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.33 |
| IUPAC Name | N-[11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxyundecyl]-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cc(CN(CC(O)CCCCCCCCCn2c(=O)c3c(ncn3C)n(C)c2=O)C(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C30H45N5O7/c1-21(36)34(18-22-16-24(40-4)27(42-6)25(17-22)41-5)19-23(37)14-12-10-8-7-9-11-13-15-35-29(38)26-28(31-20-32(26)2)33(3)30(35)39/h16-17,20,23,37H,7-15,18-19H2,1-6H3 |
| InChIKey | PEFBYSSMQITEQN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|