C27H28ClFN4O — CID 22909374
7-chloro-N-[3-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]propyl]-2-methylquinoline-4-carboxamide (PubChem CID 22909374) has the molecular formula C27H28ClFN4O and a molecular weight of 479.00 g/mol. Its IUPAC name is 7-chloro-N-[3-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]propyl]-2-methylquinoline-4-carboxamide.
| Compound Name | 7-chloro-N-[3-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]propyl]-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 22909374 |
| Molecular Formula | C27H28ClFN4O |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 7-chloro-N-[3-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]propyl]-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCN2CCC(c3c[nH]c4cc(F)ccc34)CC2)c2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C27H28ClFN4O/c1-17-13-23(21-5-3-19(28)14-26(21)32-17)27(34)30-9-2-10-33-11-7-18(8-12-33)24-16-31-25-15-20(29)4-6-22(24)25/h3-6,13-16,18,31H,2,7-12H2,1H3,(H,30,34) |
| InChIKey | YFNLSMFZOTZSEP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|