About 3,4-diethylimidazo[1,2-a]pyridin-4-ium
3,4-diethylimidazo[1,2-a]pyridin-4-ium (PubChem CID 22909639) has the molecular formula C11H15N2+
and a molecular weight of 175.25 g/mol. Its IUPAC name is 3,4-diethylimidazo[1,2-a]pyridin-4-ium.
Molecular Properties
| Compound Name | 3,4-diethylimidazo[1,2-a]pyridin-4-ium |
| PubChem CID | 22909639 |
| Molecular Formula | C11H15N2+ |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 3,4-diethylimidazo[1,2-a]pyridin-4-ium |
| SMILES | CCC1=CN=C2C=CC=C[N+]12CC |
| InChI | InChI=1S/C11H15N2/c1-3-10-9-12-11-7-5-6-8-13(10,11)4-2/h5-9H,3-4H2,1-2H3/q+1 |
| InChIKey | YSHJIIGLBVAQGZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diethylimidazo[1,2-a]pyridin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethylimidazo[1,2-a]pyridin-4-ium?
The IUPAC name of 3,4-diethylimidazo[1,2-a]pyridin-4-ium (CID 22909639) is 3,4-diethylimidazo[1,2-a]pyridin-4-ium.
What is the SMILES notation for 3,4-diethylimidazo[1,2-a]pyridin-4-ium?
The canonical SMILES for 3,4-diethylimidazo[1,2-a]pyridin-4-ium is CCC1=CN=C2C=CC=C[N+]12CC.
What is the InChIKey of 3,4-diethylimidazo[1,2-a]pyridin-4-ium?
The InChIKey is YSHJIIGLBVAQGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N2/c1-3-10-9-12-11-7-5-6-8-13(10,11)4-2/h5-9H,3-4H2,1-2H3/q+1.
What are the key properties of 3,4-diethylimidazo[1,2-a]pyridin-4-ium?
3,4-diethylimidazo[1,2-a]pyridin-4-ium has a molecular weight of 175.25 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethylimidazo[1,2-a]pyridin-4-ium is sourced from PubChem (CID 22909639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).