C20H10F26O4 — CID 22909812
(Z)-2,3-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-yl)but-2-enedioic acid (PubChem CID 22909812) has the molecular formula C20H10F26O4 and a molecular weight of 808.24 g/mol. Its IUPAC name is (Z)-2,3-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-yl)but-2-enedioic acid.
| Compound Name | (Z)-2,3-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 22909812 |
| Molecular Formula | C20H10F26O4 |
| Molecular Weight | 808.24 g/mol |
| Exact Mass | 808.02 |
| IUPAC Name | (Z)-2,3-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-yl)but-2-enedioic acid |
| SMILES | CC(/C(C(=O)O)=C(/C(=O)O)C(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H10F26O4/c1-3(9(21,22)11(25,26)13(29,30)15(33,34)17(37,38)19(41,42)43)5(7(47)48)6(8(49)50)4(2)10(23,24)12(27,28)14(31,32)16(35,36)18(39,40)20(44,45)46/h3-4H,1-2H3,(H,47,48)(H,49,50)/b6-5- |
| InChIKey | IYHWCQJWDIJMAC-WAYWQWQTSA-N |
| XLogP | 9.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.24 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|