About 4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane
4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane (PubChem CID 22909888) has the molecular formula C16H24N2O2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane.
Molecular Properties
| Compound Name | 4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane |
| PubChem CID | 22909888 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane |
| SMILES | CC(C1CCCCC1)C1CCC(N=C=O)(N=C=O)CC1 |
| InChI | InChI=1S/C16H24N2O2/c1-13(14-5-3-2-4-6-14)15-7-9-16(10-8-15,17-11-19)18-12-20/h13-15H,2-10H2,1H3 |
| InChIKey | GHWLCBBTWYXLAR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane?
The IUPAC name of 4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane (CID 22909888) is 4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane.
What is the SMILES notation for 4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane?
The canonical SMILES for 4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane is CC(C1CCCCC1)C1CCC(N=C=O)(N=C=O)CC1.
What is the InChIKey of 4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane?
The InChIKey is GHWLCBBTWYXLAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-13(14-5-3-2-4-6-14)15-7-9-16(10-8-15,17-11-19)18-12-20/h13-15H,2-10H2,1H3.
What are the key properties of 4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane?
4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane has a molecular weight of 276.38 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-cyclohexylethyl)-1,1-diisocyanatocyclohexane is sourced from PubChem (CID 22909888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).