C24H13F3O9 — CID 22909908
9-phenyl-9-(trifluoromethyl)xanthene-2,3,6,7-tetracarboxylic acid (PubChem CID 22909908) has the molecular formula C24H13F3O9 and a molecular weight of 502.35 g/mol. Its IUPAC name is 9-phenyl-9-(trifluoromethyl)xanthene-2,3,6,7-tetracarboxylic acid.
| Compound Name | 9-phenyl-9-(trifluoromethyl)xanthene-2,3,6,7-tetracarboxylic acid |
|---|---|
| PubChem CID | 22909908 |
| Molecular Formula | C24H13F3O9 |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | 9-phenyl-9-(trifluoromethyl)xanthene-2,3,6,7-tetracarboxylic acid |
| SMILES | O=C(O)c1cc2c(cc1C(=O)O)C(c1ccccc1)(C(F)(F)F)c1cc(C(=O)O)c(C(=O)O)cc1O2 |
| InChI | InChI=1S/C24H13F3O9/c25-24(26,27)23(10-4-2-1-3-5-10)15-6-11(19(28)29)13(21(32)33)8-17(15)36-18-9-14(22(34)35)12(20(30)31)7-16(18)23/h1-9H,(H,28,29)(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | VYFUAJUYFVNYHH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |