C20H31FO4 — CID 22910570
5-[(E)-but-1-enyl]-2-[2-[2-(4-fluorocyclohex-3-en-1-yl)-1,3-dioxan-5-yl]ethyl]-1,3-dioxane (PubChem CID 22910570) has the molecular formula C20H31FO4 and a molecular weight of 354.46 g/mol. Its IUPAC name is 5-[(E)-but-1-enyl]-2-[2-[2-(4-fluorocyclohex-3-en-1-yl)-1,3-dioxan-5-yl]ethyl]-1,3-dioxane.
| Compound Name | 5-[(E)-but-1-enyl]-2-[2-[2-(4-fluorocyclohex-3-en-1-yl)-1,3-dioxan-5-yl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 22910570 |
| Molecular Formula | C20H31FO4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 5-[(E)-but-1-enyl]-2-[2-[2-(4-fluorocyclohex-3-en-1-yl)-1,3-dioxan-5-yl]ethyl]-1,3-dioxane |
| SMILES | CC/C=C/C1COC(CCC2COC(C3CC=C(F)CC3)OC2)OC1 |
| InChI | InChI=1S/C20H31FO4/c1-2-3-4-15-11-22-19(23-12-15)10-5-16-13-24-20(25-14-16)17-6-8-18(21)9-7-17/h3-4,8,15-17,19-20H,2,5-7,9-14H2,1H3/b4-3+ |
| InChIKey | JFNIRXORPFVDRY-ONEGZZNKSA-N |
| XLogP | 4.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|