About 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane
2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane (PubChem CID 22910571) has the molecular formula C21H35FO4
and a molecular weight of 370.51 g/mol. Its IUPAC name is 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane.
Molecular Properties
| Compound Name | 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane |
| PubChem CID | 22910571 |
| Molecular Formula | C21H35FO4 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane |
| SMILES | CCCCCC1COC(CCC2COC(C3CC=C(F)CC3)OC2)OC1 |
| InChI | InChI=1S/C21H35FO4/c1-2-3-4-5-16-12-23-20(24-13-16)11-6-17-14-25-21(26-15-17)18-7-9-19(22)10-8-18/h9,16-18,20-21H,2-8,10-15H2,1H3 |
| InChIKey | RPCURJXQYWEXKD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane?
The IUPAC name of 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane (CID 22910571) is 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane.
What is the SMILES notation for 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane?
The canonical SMILES for 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane is CCCCCC1COC(CCC2COC(C3CC=C(F)CC3)OC2)OC1.
What is the InChIKey of 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane?
The InChIKey is RPCURJXQYWEXKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35FO4/c1-2-3-4-5-16-12-23-20(24-13-16)11-6-17-14-25-21(26-15-17)18-7-9-19(22)10-8-18/h9,16-18,20-21H,2-8,10-15H2,1H3.
What are the key properties of 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane?
2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane has a molecular weight of 370.51 g/mol, XLogP of 4.98, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane is sourced from PubChem (CID 22910571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).