C21H26F4O5 — CID 22910719
5-[(E)-but-1-enyl]-2-[2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,3-dioxan-5-yl]ethyl]-1,3-dioxane (PubChem CID 22910719) has the molecular formula C21H26F4O5 and a molecular weight of 434.43 g/mol. Its IUPAC name is 5-[(E)-but-1-enyl]-2-[2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,3-dioxan-5-yl]ethyl]-1,3-dioxane.
| Compound Name | 5-[(E)-but-1-enyl]-2-[2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,3-dioxan-5-yl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 22910719 |
| Molecular Formula | C21H26F4O5 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 5-[(E)-but-1-enyl]-2-[2-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]-1,3-dioxan-5-yl]ethyl]-1,3-dioxane |
| SMILES | CC/C=C/C1COC(CCC2COC(c3ccc(OC(F)(F)F)c(F)c3)OC2)OC1 |
| InChI | InChI=1S/C21H26F4O5/c1-2-3-4-14-10-26-19(27-11-14)8-5-15-12-28-20(29-13-15)16-6-7-18(17(22)9-16)30-21(23,24)25/h3-4,6-7,9,14-15,19-20H,2,5,8,10-13H2,1H3/b4-3+ |
| InChIKey | XRUJAMVHKVWNOW-ONEGZZNKSA-N |
| XLogP | 5.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|