C26H28N4O2 — CID 22911485
3-[2-[4-[3-(3,4-dihydro-1,2-benzodioxin-6-yl)-1H-pyrazol-5-yl]piperidin-1-yl]ethyl]-1H-indole (PubChem CID 22911485) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 3-[2-[4-[3-(3,4-dihydro-1,2-benzodioxin-6-yl)-1H-pyrazol-5-yl]piperidin-1-yl]ethyl]-1H-indole.
| Compound Name | 3-[2-[4-[3-(3,4-dihydro-1,2-benzodioxin-6-yl)-1H-pyrazol-5-yl]piperidin-1-yl]ethyl]-1H-indole |
|---|---|
| PubChem CID | 22911485 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 3-[2-[4-[3-(3,4-dihydro-1,2-benzodioxin-6-yl)-1H-pyrazol-5-yl]piperidin-1-yl]ethyl]-1H-indole |
| SMILES | c1ccc2c(CCN3CCC(c4cc(-c5ccc6c(c5)CCOO6)n[nH]4)CC3)c[nH]c2c1 |
| InChI | InChI=1S/C26H28N4O2/c1-2-4-23-22(3-1)21(17-27-23)9-13-30-11-7-18(8-12-30)24-16-25(29-28-24)19-5-6-26-20(15-19)10-14-31-32-26/h1-6,15-18,27H,7-14H2,(H,28,29) |
| InChIKey | MPGWMFCZHUMUOX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 66.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|