C16H14N2O5 — CID 22911565
4-(3-isocyanatophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 22911565) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 4-(3-isocyanatophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-(3-isocyanatophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 22911565 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-(3-isocyanatophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc(N=C=O)c2)C(C(=O)O)=C(C)N1 |
| InChI | InChI=1S/C16H14N2O5/c1-8-12(15(20)21)14(13(16(22)23)9(2)18-8)10-4-3-5-11(6-10)17-7-19/h3-6,14,18H,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | ORHRDRZVJCHCSK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|