About bis(prop-2-enyl)azanium;prop-2-enamide;chloride
bis(prop-2-enyl)azanium;prop-2-enamide;chloride (PubChem CID 22912602) has the molecular formula C9H17ClN2O
and a molecular weight of 204.70 g/mol. Its IUPAC name is bis(prop-2-enyl)azanium;prop-2-enamide;chloride.
Molecular Properties
| Compound Name | bis(prop-2-enyl)azanium;prop-2-enamide;chloride |
| PubChem CID | 22912602 |
| Molecular Formula | C9H17ClN2O |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | bis(prop-2-enyl)azanium;prop-2-enamide;chloride |
| SMILES | C=CC(N)=O.C=CC[NH2+]CC=C.[Cl-] |
| InChI | InChI=1S/C6H11N.C3H5NO.ClH/c1-3-5-7-6-4-2;1-2-3(4)5;/h3-4,7H,1-2,5-6H2;2H,1H2,(H2,4,5);1H |
| InChIKey | ANPGKUATKQCFHS-UHFFFAOYSA-N |
| XLogP | -3.42 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(prop-2-enyl)azanium;prop-2-enamide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(prop-2-enyl)azanium;prop-2-enamide;chloride?
The IUPAC name of bis(prop-2-enyl)azanium;prop-2-enamide;chloride (CID 22912602) is bis(prop-2-enyl)azanium;prop-2-enamide;chloride.
What is the SMILES notation for bis(prop-2-enyl)azanium;prop-2-enamide;chloride?
The canonical SMILES for bis(prop-2-enyl)azanium;prop-2-enamide;chloride is C=CC(N)=O.C=CC[NH2+]CC=C.[Cl-].
What is the InChIKey of bis(prop-2-enyl)azanium;prop-2-enamide;chloride?
The InChIKey is ANPGKUATKQCFHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.C3H5NO.ClH/c1-3-5-7-6-4-2;1-2-3(4)5;/h3-4,7H,1-2,5-6H2;2H,1H2,(H2,4,5);1H.
What are the key properties of bis(prop-2-enyl)azanium;prop-2-enamide;chloride?
bis(prop-2-enyl)azanium;prop-2-enamide;chloride has a molecular weight of 204.70 g/mol, XLogP of -3.42, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(prop-2-enyl)azanium;prop-2-enamide;chloride is sourced from PubChem (CID 22912602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).