C9H6ClF3N6 — CID 22912794
5-amino-1-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]pyrazole-4-carbonitrile (PubChem CID 22912794) has the molecular formula C9H6ClF3N6 and a molecular weight of 290.64 g/mol. Its IUPAC name is 5-amino-1-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 22912794 |
| Molecular Formula | C9H6ClF3N6 |
| Molecular Weight | 290.64 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 5-amino-1-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]pyrazole-4-carbonitrile |
| SMILES | Cn1nc(-n2ncc(C#N)c2N)c(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C9H6ClF3N6/c1-18-6(9(11,12)13)5(10)8(17-18)19-7(15)4(2-14)3-16-19/h3H,15H2,1H3 |
| InChIKey | XQERDWMJANWLPR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.64 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |